French
DeutschDiheptylftalaat
| Diheptylftalaat | ||||
|---|---|---|---|---|
| Structuurformule en molecuulmodel | ||||
 | ||||
Structuurformule van diheptylftalaat | ||||
| Algemeen | ||||
| Molecuulformule | C22H34O4 | |||
| IUPAC-naam | diheptylbenzeen-1,2-dicarboxylaat | |||
| Andere namen | DHP, di-n-heptylftalaat | |||
| Molmassa | 362,50296 g/mol | |||
| SMILES | CCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC | |||
| InChI | 1S/C22H34O4/c1-3-5-7-9-13-17-25-21(23)19- 15-11-12-16-20(19)22(24)26-18-14-10-8-6-4- 2/h11-12,15-16H,3-10,13-14,17-18H2,1-2H3 | |||
| CAS-nummer | 3648-21-3 | |||
| EG-nummer | 222-885-4 | |||
| PubChem | 19284 | |||
| Wikidata | Q2943515 | |||
| Beschrijving | Kleurloze vloeistof | |||
| Waarschuwingen en veiligheidsmaatregelen | ||||
| ||||
| H-zinnen | H315 - H319 - H335 - H361 | |||
| EUH-zinnen | geen | |||
| P-zinnen | P261 - P281 - P305+P351+P338 | |||
| Fysische eigenschappen | ||||
| Aggregatietoestand | vloeibaar | |||
| Kleur | kleurloos | |||
| Dichtheid | 0,992 g/cm³ | |||
| Kookpunt | 360 °C | |||
| Vlampunt | (gesloten vat) 224 °C | |||
| Dampdruk | (bij 20°C) 0,2 Pa | |||
| Slecht oplosbaar in | water | |||
| log(Pow) | ± 7,6 | |||
| Tenzij anders vermeld zijn standaardomstandigheden gebruikt (298,15 K of 25 °C, 1 bar). | ||||
| ||||
Diheptylftalaat of DHP (Engels: diheptyl phthalate) is een organische verbinding met als brutoformule C22H34O4. De stof komt voor als een reukloze kleurloze vloeistof, die zeer slecht oplosbaar is in water.
Diheptylftalaat wordt gebruikt als weekmaker.
